C14H14O2S — CID 91481868
3-(4-sulfanylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 91481868) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 3-(4-sulfanylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-(4-sulfanylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 91481868 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-(4-sulfanylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)C1C2C=CC(C2)C1c1ccc(S)cc1 |
| InChI | InChI=1S/C14H14O2S/c15-14(16)13-10-2-1-9(7-10)12(13)8-3-5-11(17)6-4-8/h1-6,9-10,12-13,17H,7H2,(H,15,16) |
| InChIKey | DEPROPAJUAEZOB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|