C19H17NO — CID 102003806
[(1R,2R,3R,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone (PubChem CID 102003806) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone.
| Compound Name | [(1R,2R,3R,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 102003806 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | [(1R,2R,3R,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)[C@H]1[C@H](c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C19H17NO/c21-19(16-8-4-5-11-20-16)18-15-10-9-14(12-15)17(18)13-6-2-1-3-7-13/h1-11,14-15,17-18H,12H2/t14-,15+,17-,18-/m1/s1 |
| InChIKey | ITLBWWBLBQJKTH-CYGHRXIMSA-N |
| XLogP | 3.87 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|