C20H18NNaO4S — CID 101039252
sodium [4-[(1S,2S,3S,4R)-3-(pyridine-2-carbonyl)-2-bicyclo[2.2.1]hept-5-enyl]phenyl]methanesulfonate (PubChem CID 101039252) has the molecular formula C20H18NNaO4S and a molecular weight of 391.42 g/mol. Its IUPAC name is sodium [4-[(1S,2S,3S,4R)-3-(pyridine-2-carbonyl)-2-bicyclo[2.2.1]hept-5-enyl]phenyl]methanesulfonate.
| Compound Name | sodium [4-[(1S,2S,3S,4R)-3-(pyridine-2-carbonyl)-2-bicyclo[2.2.1]hept-5-enyl]phenyl]methanesulfonate |
|---|---|
| PubChem CID | 101039252 |
| Molecular Formula | C20H18NNaO4S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | sodium [4-[(1S,2S,3S,4R)-3-(pyridine-2-carbonyl)-2-bicyclo[2.2.1]hept-5-enyl]phenyl]methanesulfonate |
| SMILES | O=C(c1ccccn1)[C@@H]1[C@@H](c2ccc(CS(=O)(=O)[O-])cc2)[C@@H]2C=C[C@H]1C2.[Na+] |
| InChI | InChI=1S/C20H19NO4S.Na/c22-20(17-3-1-2-10-21-17)19-16-9-8-15(11-16)18(19)14-6-4-13(5-7-14)12-26(23,24)25;/h1-10,15-16,18-19H,11-12H2,(H,23,24,25);/q;+1/p-1/t15-,16+,18+,19+;/m1./s1 |
| InChIKey | ACCOJXOLTBUIRI-JNDCXILUSA-M |
| XLogP | -0.08 |
| TPSA | 87.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|