C26H30Br2N2O — CID 101039251
[(1R,2R,3R,4S)-3-[4-[[bis(3-bromopropyl)amino]methyl]phenyl]-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone (PubChem CID 101039251) has the molecular formula C26H30Br2N2O and a molecular weight of 546.35 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-3-[4-[[bis(3-bromopropyl)amino]methyl]phenyl]-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone.
| Compound Name | [(1R,2R,3R,4S)-3-[4-[[bis(3-bromopropyl)amino]methyl]phenyl]-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 101039251 |
| Molecular Formula | C26H30Br2N2O |
| Molecular Weight | 546.35 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | [(1R,2R,3R,4S)-3-[4-[[bis(3-bromopropyl)amino]methyl]phenyl]-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)[C@H]1[C@H](c2ccc(CN(CCCBr)CCCBr)cc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C26H30Br2N2O/c27-12-3-15-30(16-4-13-28)18-19-6-8-20(9-7-19)24-21-10-11-22(17-21)25(24)26(31)23-5-1-2-14-29-23/h1-2,5-11,14,21-22,24-25H,3-4,12-13,15-18H2/t21-,22+,24-,25-/m1/s1 |
| InChIKey | OJHLSIODHJXHQT-PEISPCAHSA-N |
| XLogP | 6.24 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|