C14H13FO2 — CID 68970816
3-(2-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 68970816) has the molecular formula C14H13FO2 and a molecular weight of 232.25 g/mol. Its IUPAC name is 3-(2-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-(2-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 68970816 |
| Molecular Formula | C14H13FO2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 3-(2-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)C1C2C=CC(C2)C1c1ccccc1F |
| InChI | InChI=1S/C14H13FO2/c15-11-4-2-1-3-10(11)12-8-5-6-9(7-8)13(12)14(16)17/h1-6,8-9,12-13H,7H2,(H,16,17) |
| InChIKey | CVONMJUENUXSEU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|