C13H12 — CID 11095035
(1S,2R,9S,10R)-tetracyclo[8.2.1.02,9.03,8]trideca-3,5,7,11-tetraene (PubChem CID 11095035) has the molecular formula C13H12 and a molecular weight of 168.24 g/mol. Its IUPAC name is (1S,2R,9S,10R)-tetracyclo[8.2.1.02,9.03,8]trideca-3,5,7,11-tetraene.
| Compound Name | (1S,2R,9S,10R)-tetracyclo[8.2.1.02,9.03,8]trideca-3,5,7,11-tetraene |
|---|---|
| PubChem CID | 11095035 |
| Molecular Formula | C13H12 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (1S,2R,9S,10R)-tetracyclo[8.2.1.02,9.03,8]trideca-3,5,7,11-tetraene |
| SMILES | C1=C[C@H]2C[C@@H]1[C@H]1c3ccccc3[C@H]12 |
| InChI | InChI=1S/C13H12/c1-2-4-11-10(3-1)12-8-5-6-9(7-8)13(11)12/h1-6,8-9,12-13H,7H2/t8-,9+,12+,13- |
| InChIKey | QEJLOYGOJABAKP-JDNZLRHBSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|