C13H14ClNO2 — CID 22210063
3-(2-chlorophenyl)-N-hydroxybicyclo[2.2.1]hept-5-en-2-amine oxide (PubChem CID 22210063) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-hydroxybicyclo[2.2.1]hept-5-en-2-amine oxide.
| Compound Name | 3-(2-chlorophenyl)-N-hydroxybicyclo[2.2.1]hept-5-en-2-amine oxide |
|---|---|
| PubChem CID | 22210063 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-(2-chlorophenyl)-N-hydroxybicyclo[2.2.1]hept-5-en-2-amine oxide |
| SMILES | [O-][NH+](O)C1C2C=CC(C2)C1c1ccccc1Cl |
| InChI | InChI=1S/C13H14ClNO2/c14-11-4-2-1-3-10(11)12-8-5-6-9(7-8)13(12)15(16)17/h1-6,8-9,12-13,15-16H,7H2 |
| InChIKey | DTKPYAKNWVMZIU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|