C17H20O5 — CID 90790124
3-(2,4,5-trimethoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 90790124) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-(2,4,5-trimethoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-(2,4,5-trimethoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 90790124 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-(2,4,5-trimethoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COc1cc(OC)c(C2C3C=CC(C3)C2C(=O)O)cc1OC |
| InChI | InChI=1S/C17H20O5/c1-20-12-8-14(22-3)13(21-2)7-11(12)15-9-4-5-10(6-9)16(15)17(18)19/h4-5,7-10,15-16H,6H2,1-3H3,(H,18,19) |
| InChIKey | BGGPRFBPQULTDP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|