C16H19N3O2 — CID 54282462
(2S,3S)-N-(diaminomethylidene)-3-(2-methoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 54282462) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is (2S,3S)-N-(diaminomethylidene)-3-(2-methoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (2S,3S)-N-(diaminomethylidene)-3-(2-methoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 54282462 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (2S,3S)-N-(diaminomethylidene)-3-(2-methoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | COc1ccccc1[C@H]1C2C=CC(C2)[C@@H]1C(=O)N=C(N)N |
| InChI | InChI=1S/C16H19N3O2/c1-21-12-5-3-2-4-11(12)13-9-6-7-10(8-9)14(13)15(20)19-16(17)18/h2-7,9-10,13-14H,8H2,1H3,(H4,17,18,19,20)/t9?,10?,13-,14+/m1/s1 |
| InChIKey | RRSYUOBULHSAEB-FEZLSPKCSA-N |
| XLogP | 1.40 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|