C18H22O4 — CID 68970231
3-[3-(2,3-dimethoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]propanoic acid (PubChem CID 68970231) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-[3-(2,3-dimethoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]propanoic acid.
| Compound Name | 3-[3-(2,3-dimethoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]propanoic acid |
|---|---|
| PubChem CID | 68970231 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-[3-(2,3-dimethoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]propanoic acid |
| SMILES | COc1cccc(C2C3C=CC(C3)C2CCC(=O)O)c1OC |
| InChI | InChI=1S/C18H22O4/c1-21-15-5-3-4-14(18(15)22-2)17-12-7-6-11(10-12)13(17)8-9-16(19)20/h3-7,11-13,17H,8-10H2,1-2H3,(H,19,20) |
| InChIKey | IDLWLGZXDHLCBS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|