C13H17NO2 — CID 83822143
6-(2,3-dimethoxyphenyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 83822143) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 6-(2,3-dimethoxyphenyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | 6-(2,3-dimethoxyphenyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 83822143 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 6-(2,3-dimethoxyphenyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | COc1cccc(C2C3CNCC32)c1OC |
| InChI | InChI=1S/C13H17NO2/c1-15-11-5-3-4-8(13(11)16-2)12-9-6-14-7-10(9)12/h3-5,9-10,12,14H,6-7H2,1-2H3 |
| InChIKey | GFMNHHVQIYOHIV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |