C32H28O5 — CID 102090614
2-O-ethyl 3-O-[8-(8-methoxynaphthalen-1-yl)naphthalen-1-yl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 102090614) has the molecular formula C32H28O5 and a molecular weight of 492.57 g/mol. Its IUPAC name is 2-O-ethyl 3-O-[8-(8-methoxynaphthalen-1-yl)naphthalen-1-yl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | 2-O-ethyl 3-O-[8-(8-methoxynaphthalen-1-yl)naphthalen-1-yl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102090614 |
| Molecular Formula | C32H28O5 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-O-ethyl 3-O-[8-(8-methoxynaphthalen-1-yl)naphthalen-1-yl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1C2C=CC(C2)C1C(=O)Oc1cccc2cccc(-c3cccc4cccc(OC)c34)c12 |
| InChI | InChI=1S/C32H28O5/c1-3-36-31(33)29-21-16-17-22(18-21)30(29)32(34)37-26-15-7-11-20-9-5-13-24(28(20)26)23-12-4-8-19-10-6-14-25(35-2)27(19)23/h4-17,21-22,29-30H,3,18H2,1-2H3 |
| InChIKey | WHUGYTWXWJGGRE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|