C26H24O4 — CID 122505339
3-methyl-2-[8-(4-methylcyclohex-2-ene-1-carbonyl)oxynaphthalen-1-yl]benzoic acid (PubChem CID 122505339) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is 3-methyl-2-[8-(4-methylcyclohex-2-ene-1-carbonyl)oxynaphthalen-1-yl]benzoic acid.
| Compound Name | 3-methyl-2-[8-(4-methylcyclohex-2-ene-1-carbonyl)oxynaphthalen-1-yl]benzoic acid |
|---|---|
| PubChem CID | 122505339 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3-methyl-2-[8-(4-methylcyclohex-2-ene-1-carbonyl)oxynaphthalen-1-yl]benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1-c1cccc2cccc(OC(=O)C3C=CC(C)CC3)c12 |
| InChI | InChI=1S/C26H24O4/c1-16-12-14-19(15-13-16)26(29)30-22-11-5-8-18-7-4-9-20(24(18)22)23-17(2)6-3-10-21(23)25(27)28/h3-12,14,16,19H,13,15H2,1-2H3,(H,27,28) |
| InChIKey | VGIYUSYJLJZJHB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|