C23H22O4 — CID 142748160
bis(3-methylphenyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 142748160) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is bis(3-methylphenyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(3-methylphenyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142748160 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | bis(3-methylphenyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | Cc1cccc(OC(=O)C2C3C=CC(C3)C2C(=O)Oc2cccc(C)c2)c1 |
| InChI | InChI=1S/C23H22O4/c1-14-5-3-7-18(11-14)26-22(24)20-16-9-10-17(13-16)21(20)23(25)27-19-8-4-6-15(2)12-19/h3-12,16-17,20-21H,13H2,1-2H3 |
| InChIKey | YZKUHBIVCZTRMS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|