C17H17NO3 — CID 51346284
3-[(1R,2S,3R,4S)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 51346284) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[(1R,2S,3R,4S)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1R,2S,3R,4S)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 51346284 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-[(1R,2S,3R,4S)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C(=O)[C@@H]1[C@H](c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C17H17NO3/c19-16(18-8-9-21-17(18)20)15-13-7-6-12(10-13)14(15)11-4-2-1-3-5-11/h1-7,12-15H,8-10H2/t12-,13+,14-,15+/m1/s1 |
| InChIKey | CXYHUBVSSKWUFZ-BARDWOONSA-N |
| XLogP | 2.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|