C28H25NO3 — CID 154385440
(4R)-4-benzyl-3-(3-naphthalen-2-ylbicyclo[2.2.1]hept-5-ene-2-carbonyl)-1,3-oxazolidin-2-one (PubChem CID 154385440) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is (4R)-4-benzyl-3-(3-naphthalen-2-ylbicyclo[2.2.1]hept-5-ene-2-carbonyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-(3-naphthalen-2-ylbicyclo[2.2.1]hept-5-ene-2-carbonyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 154385440 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (4R)-4-benzyl-3-(3-naphthalen-2-ylbicyclo[2.2.1]hept-5-ene-2-carbonyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](Cc2ccccc2)N1C(=O)C1C2C=CC(C2)C1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H25NO3/c30-27(29-24(17-32-28(29)31)14-18-6-2-1-3-7-18)26-23-13-12-22(16-23)25(26)21-11-10-19-8-4-5-9-20(19)15-21/h1-13,15,22-26H,14,16-17H2/t22?,23?,24-,25?,26?/m1/s1 |
| InChIKey | YGPPDCQCTOKTMI-UCBLTYHBSA-N |
| XLogP | 5.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|