C22H21NO4 — CID 100995557
(4S)-4-benzyl-3-(3-methyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carbonyl)-1,3-oxazolidin-2-one (PubChem CID 100995557) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(3-methyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carbonyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(3-methyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carbonyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 100995557 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (4S)-4-benzyl-3-(3-methyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carbonyl)-1,3-oxazolidin-2-one |
| SMILES | CC1=C(C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)C(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C22H21NO4/c1-12-17-14-7-8-15(10-14)19(17)20(24)18(12)21(25)23-16(11-27-22(23)26)9-13-5-3-2-4-6-13/h2-8,14-17,19H,9-11H2,1H3/t14?,15?,16-,17?,19?/m0/s1 |
| InChIKey | JGOPULMPVYLCJG-PVMITTFQSA-N |
| XLogP | 2.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|