C24H29NO4Si — CID 100995545
(4S)-4-benzyl-3-[(1R,2R,6S,7S)-5-oxo-4-trimethylsilyltricyclo[5.2.1.02,6]dec-3-ene-3-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 100995545) has the molecular formula C24H29NO4Si and a molecular weight of 423.59 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(1R,2R,6S,7S)-5-oxo-4-trimethylsilyltricyclo[5.2.1.02,6]dec-3-ene-3-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(1R,2R,6S,7S)-5-oxo-4-trimethylsilyltricyclo[5.2.1.02,6]dec-3-ene-3-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 100995545 |
| Molecular Formula | C24H29NO4Si |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (4S)-4-benzyl-3-[(1R,2R,6S,7S)-5-oxo-4-trimethylsilyltricyclo[5.2.1.02,6]dec-3-ene-3-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)C1=C(C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C24H29NO4Si/c1-30(2,3)22-20(18-15-9-10-16(12-15)19(18)21(22)26)23(27)25-17(13-29-24(25)28)11-14-7-5-4-6-8-14/h4-8,15-19H,9-13H2,1-3H3/t15-,16+,17+,18-,19+/m1/s1 |
| InChIKey | JKXZMBDEWVYNKV-SPOLIRPYSA-N |
| XLogP | 4.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|