C23H27NO4Si — CID 10716462
(4S)-3-[(1R,2S,6R,7S)-5-oxo-4-trimethylsilyltricyclo[5.2.1.02,6]dec-3-ene-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10716462) has the molecular formula C23H27NO4Si and a molecular weight of 409.56 g/mol. Its IUPAC name is (4S)-3-[(1R,2S,6R,7S)-5-oxo-4-trimethylsilyltricyclo[5.2.1.02,6]dec-3-ene-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(1R,2S,6R,7S)-5-oxo-4-trimethylsilyltricyclo[5.2.1.02,6]dec-3-ene-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10716462 |
| Molecular Formula | C23H27NO4Si |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (4S)-3-[(1R,2S,6R,7S)-5-oxo-4-trimethylsilyltricyclo[5.2.1.02,6]dec-3-ene-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)C1=C(C(=O)N2C(=O)OC[C@@H]2c2ccccc2)[C@H]2[C@@H]3CC[C@@H](C3)[C@H]2C1=O |
| InChI | InChI=1S/C23H27NO4Si/c1-29(2,3)21-19(17-14-9-10-15(11-14)18(17)20(21)25)22(26)24-16(12-28-23(24)27)13-7-5-4-6-8-13/h4-8,14-18H,9-12H2,1-3H3/t14-,15+,16-,17+,18-/m1/s1 |
| InChIKey | LVHZTSUBMOIKHE-MDMSPXHWSA-N |
| XLogP | 4.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|