About (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one
(4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one (PubChem CID 14911082) has the molecular formula C21H18N2O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one |
| PubChem CID | 14911082 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H18N2O4/c1-14-18(19(22-27-14)16-10-6-3-7-11-16)20(24)23-17(13-26-21(23)25)12-15-8-4-2-5-9-15/h2-11,17H,12-13H2,1H3/t17-/m0/s1 |
| InChIKey | UGIOWFPZTWOERR-KRWDZBQOSA-N |
| XLogP | 3.85 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one?
The IUPAC name of (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one (CID 14911082) is (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one?
The canonical SMILES for (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one is Cc1onc(-c2ccccc2)c1C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1.
What is the InChIKey of (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one?
The InChIKey is UGIOWFPZTWOERR-KRWDZBQOSA-N. The full InChI is InChI=1S/C21H18N2O4/c1-14-18(19(22-27-14)16-10-6-3-7-11-16)20(24)23-17(13-26-21(23)25)12-15-8-4-2-5-9-15/h2-11,17H,12-13H2,1H3/t17-/m0/s1.
What are the key properties of (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one?
(4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one has a molecular weight of 362.39 g/mol, XLogP of 3.85, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-benzyl-3-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 14911082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).