C19H19NO3 — CID 72957232
4-benzyl-3-[2-(4-methylphenyl)acetyl]-1,3-oxazolidin-2-one (PubChem CID 72957232) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-benzyl-3-[2-(4-methylphenyl)acetyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[2-(4-methylphenyl)acetyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 72957232 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-benzyl-3-[2-(4-methylphenyl)acetyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(CC(=O)N2C(=O)OCC2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-14-7-9-16(10-8-14)12-18(21)20-17(13-23-19(20)22)11-15-5-3-2-4-6-15/h2-10,17H,11-13H2,1H3 |
| InChIKey | JADHSZKFTKCAIF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |