C16H18O2 — CID 91467684
3-(3-phenyl-2-bicyclo[2.2.1]hept-5-enyl)propanoic acid (PubChem CID 91467684) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-(3-phenyl-2-bicyclo[2.2.1]hept-5-enyl)propanoic acid.
| Compound Name | 3-(3-phenyl-2-bicyclo[2.2.1]hept-5-enyl)propanoic acid |
|---|---|
| PubChem CID | 91467684 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-(3-phenyl-2-bicyclo[2.2.1]hept-5-enyl)propanoic acid |
| SMILES | O=C(O)CCC1C2C=CC(C2)C1c1ccccc1 |
| InChI | InChI=1S/C16H18O2/c17-15(18)9-8-14-12-6-7-13(10-12)16(14)11-4-2-1-3-5-11/h1-7,12-14,16H,8-10H2,(H,17,18) |
| InChIKey | MDLRUPMKUQNNLF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|