C24H20O — CID 142808769
(4S)-5-methyl-2,3,4-triphenylcyclopent-2-en-1-one (PubChem CID 142808769) has the molecular formula C24H20O and a molecular weight of 324.42 g/mol. Its IUPAC name is (4S)-5-methyl-2,3,4-triphenylcyclopent-2-en-1-one.
| Compound Name | (4S)-5-methyl-2,3,4-triphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 142808769 |
| Molecular Formula | C24H20O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (4S)-5-methyl-2,3,4-triphenylcyclopent-2-en-1-one |
| SMILES | CC1C(=O)C(c2ccccc2)=C(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H20O/c1-17-21(18-11-5-2-6-12-18)22(19-13-7-3-8-14-19)23(24(17)25)20-15-9-4-10-16-20/h2-17,21H,1H3/t17?,21-/m0/s1 |
| InChIKey | VEFOETBKPCXNGW-LFABVHOISA-N |
| XLogP | 5.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|