C18H15FO — CID 138979307
(4S,5R)-5-fluoro-2-methyl-3,4-diphenylcyclopent-2-en-1-one (PubChem CID 138979307) has the molecular formula C18H15FO and a molecular weight of 266.32 g/mol. Its IUPAC name is (4S,5R)-5-fluoro-2-methyl-3,4-diphenylcyclopent-2-en-1-one.
| Compound Name | (4S,5R)-5-fluoro-2-methyl-3,4-diphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 138979307 |
| Molecular Formula | C18H15FO |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (4S,5R)-5-fluoro-2-methyl-3,4-diphenylcyclopent-2-en-1-one |
| SMILES | CC1=C(c2ccccc2)[C@H](c2ccccc2)[C@@H](F)C1=O |
| InChI | InChI=1S/C18H15FO/c1-12-15(13-8-4-2-5-9-13)16(17(19)18(12)20)14-10-6-3-7-11-14/h2-11,16-17H,1H3/t16-,17+/m0/s1 |
| InChIKey | VWPVMJYTMVGMFQ-DLBZAZTESA-N |
| XLogP | 4.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |