C22H22O — CID 102142073
(5Z)-5-butan-2-ylidene-2-methyl-3,4-diphenylcyclopent-2-en-1-one (PubChem CID 102142073) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is (5Z)-5-butan-2-ylidene-2-methyl-3,4-diphenylcyclopent-2-en-1-one.
| Compound Name | (5Z)-5-butan-2-ylidene-2-methyl-3,4-diphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 102142073 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (5Z)-5-butan-2-ylidene-2-methyl-3,4-diphenylcyclopent-2-en-1-one |
| SMILES | CC/C(C)=C1\C(=O)C(C)=C(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C22H22O/c1-4-15(2)19-21(18-13-9-6-10-14-18)20(16(3)22(19)23)17-11-7-5-8-12-17/h5-14,21H,4H2,1-3H3/b19-15- |
| InChIKey | NEZKTZFJSYKADP-CYVLTUHYSA-N |
| XLogP | 5.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|