C20H18O3 — CID 11120333
(5E)-2-hydroxy-5-(3-hydroxypropylidene)-3,4-diphenylcyclopent-2-en-1-one (PubChem CID 11120333) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (5E)-2-hydroxy-5-(3-hydroxypropylidene)-3,4-diphenylcyclopent-2-en-1-one.
| Compound Name | (5E)-2-hydroxy-5-(3-hydroxypropylidene)-3,4-diphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11120333 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (5E)-2-hydroxy-5-(3-hydroxypropylidene)-3,4-diphenylcyclopent-2-en-1-one |
| SMILES | O=C1C(O)=C(c2ccccc2)C(c2ccccc2)/C1=C\CCO |
| InChI | InChI=1S/C20H18O3/c21-13-7-12-16-17(14-8-3-1-4-9-14)18(20(23)19(16)22)15-10-5-2-6-11-15/h1-6,8-12,17,21,23H,7,13H2/b16-12+ |
| InChIKey | KUURLBMVVZKHSX-FOWTUZBSSA-N |
| XLogP | 3.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|