C20H16O2 — CID 14170822
3-acetyl-4-methyl-2,5-diphenylcyclopenta-2,4-dien-1-one (PubChem CID 14170822) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-acetyl-4-methyl-2,5-diphenylcyclopenta-2,4-dien-1-one.
| Compound Name | 3-acetyl-4-methyl-2,5-diphenylcyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 14170822 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-acetyl-4-methyl-2,5-diphenylcyclopenta-2,4-dien-1-one |
| SMILES | CC(=O)C1=C(c2ccccc2)C(=O)C(c2ccccc2)=C1C |
| InChI | InChI=1S/C20H16O2/c1-13-17(14(2)21)19(16-11-7-4-8-12-16)20(22)18(13)15-9-5-3-6-10-15/h3-12H,1-2H3 |
| InChIKey | IXARNPSZFIRRPJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |