C14H14O4 — CID 10681851
5-acetyl-2,2-dimethyl-6-phenyl-1,3-dioxin-4-one (PubChem CID 10681851) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 5-acetyl-2,2-dimethyl-6-phenyl-1,3-dioxin-4-one.
| Compound Name | 5-acetyl-2,2-dimethyl-6-phenyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10681851 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-acetyl-2,2-dimethyl-6-phenyl-1,3-dioxin-4-one |
| SMILES | CC(=O)C1=C(c2ccccc2)OC(C)(C)OC1=O |
| InChI | InChI=1S/C14H14O4/c1-9(15)11-12(10-7-5-4-6-8-10)17-14(2,3)18-13(11)16/h4-8H,1-3H3 |
| InChIKey | QSYJDQPRYUHMRA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|