C16H18O4 — CID 12525627
ethyl 2,2-dimethyl-4-oxo-6-phenyl-3H-pyran-5-carboxylate (PubChem CID 12525627) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-4-oxo-6-phenyl-3H-pyran-5-carboxylate.
| Compound Name | ethyl 2,2-dimethyl-4-oxo-6-phenyl-3H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 12525627 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | ethyl 2,2-dimethyl-4-oxo-6-phenyl-3H-pyran-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)OC(C)(C)CC1=O |
| InChI | InChI=1S/C16H18O4/c1-4-19-15(18)13-12(17)10-16(2,3)20-14(13)11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3 |
| InChIKey | RTRXMEMFEDYLOY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|