C14H12O5 — CID 116851673
ethyl 2-(4-methylphenyl)-4,5-dioxofuran-3-carboxylate (PubChem CID 116851673) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is ethyl 2-(4-methylphenyl)-4,5-dioxofuran-3-carboxylate.
| Compound Name | ethyl 2-(4-methylphenyl)-4,5-dioxofuran-3-carboxylate |
|---|---|
| PubChem CID | 116851673 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | ethyl 2-(4-methylphenyl)-4,5-dioxofuran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(C)cc2)OC(=O)C1=O |
| InChI | InChI=1S/C14H12O5/c1-3-18-13(16)10-11(15)14(17)19-12(10)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3 |
| InChIKey | ATUSROLTEYTAKH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|