C30H28O3 — CID 102235999
ethyl 4,5-bis(2,4-dimethylphenyl)-3-oxo-2-phenylcyclopenta-1,4-diene-1-carboxylate (PubChem CID 102235999) has the molecular formula C30H28O3 and a molecular weight of 436.55 g/mol. Its IUPAC name is ethyl 4,5-bis(2,4-dimethylphenyl)-3-oxo-2-phenylcyclopenta-1,4-diene-1-carboxylate.
| Compound Name | ethyl 4,5-bis(2,4-dimethylphenyl)-3-oxo-2-phenylcyclopenta-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 102235999 |
| Molecular Formula | C30H28O3 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | ethyl 4,5-bis(2,4-dimethylphenyl)-3-oxo-2-phenylcyclopenta-1,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)C(=O)C(c2ccc(C)cc2C)=C1c1ccc(C)cc1C |
| InChI | InChI=1S/C30H28O3/c1-6-33-30(32)28-25(22-10-8-7-9-11-22)29(31)27(24-15-13-19(3)17-21(24)5)26(28)23-14-12-18(2)16-20(23)4/h7-17H,6H2,1-5H3 |
| InChIKey | UMTSCTLDOPPFQQ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|