C24H20O8 — CID 139043399
diethyl 3,6-dioxo-2,5-diphenoxycyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 139043399) has the molecular formula C24H20O8 and a molecular weight of 436.42 g/mol. Its IUPAC name is diethyl 3,6-dioxo-2,5-diphenoxycyclohexa-1,4-diene-1,4-dicarboxylate.
| Compound Name | diethyl 3,6-dioxo-2,5-diphenoxycyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139043399 |
| Molecular Formula | C24H20O8 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | diethyl 3,6-dioxo-2,5-diphenoxycyclohexa-1,4-diene-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(Oc2ccccc2)C(=O)C(C(=O)OCC)=C(Oc2ccccc2)C1=O |
| InChI | InChI=1S/C24H20O8/c1-3-29-23(27)17-19(25)22(32-16-13-9-6-10-14-16)18(24(28)30-4-2)20(26)21(17)31-15-11-7-5-8-12-15/h5-14H,3-4H2,1-2H3 |
| InChIKey | ZTNBZFCWDKQFPA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|