C36H27NO3 — CID 139201220
ethyl 3-oxo-1-phenyl-5-[4-(N-phenylanilino)phenyl]indene-2-carboxylate (PubChem CID 139201220) has the molecular formula C36H27NO3 and a molecular weight of 521.62 g/mol. Its IUPAC name is ethyl 3-oxo-1-phenyl-5-[4-(N-phenylanilino)phenyl]indene-2-carboxylate.
| Compound Name | ethyl 3-oxo-1-phenyl-5-[4-(N-phenylanilino)phenyl]indene-2-carboxylate |
|---|---|
| PubChem CID | 139201220 |
| Molecular Formula | C36H27NO3 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | ethyl 3-oxo-1-phenyl-5-[4-(N-phenylanilino)phenyl]indene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2C1=O |
| InChI | InChI=1S/C36H27NO3/c1-2-40-36(39)34-33(26-12-6-3-7-13-26)31-23-20-27(24-32(31)35(34)38)25-18-21-30(22-19-25)37(28-14-8-4-9-15-28)29-16-10-5-11-17-29/h3-24H,2H2,1H3 |
| InChIKey | RHKCFGFLNHKKFS-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|