C45H40O8 — CID 69131345
ethyl 1-benzyl-1-hydroxy-6-methoxy-3-phenylindene-2-carboxylate;ethyl 5-methoxy-3-oxo-1-phenylindene-2-carboxylate (PubChem CID 69131345) has the molecular formula C45H40O8 and a molecular weight of 708.81 g/mol. Its IUPAC name is ethyl 1-benzyl-1-hydroxy-6-methoxy-3-phenylindene-2-carboxylate;ethyl 5-methoxy-3-oxo-1-phenylindene-2-carboxylate.
| Compound Name | ethyl 1-benzyl-1-hydroxy-6-methoxy-3-phenylindene-2-carboxylate;ethyl 5-methoxy-3-oxo-1-phenylindene-2-carboxylate |
|---|---|
| PubChem CID | 69131345 |
| Molecular Formula | C45H40O8 |
| Molecular Weight | 708.81 g/mol |
| Exact Mass | 708.27 |
| IUPAC Name | ethyl 1-benzyl-1-hydroxy-6-methoxy-3-phenylindene-2-carboxylate;ethyl 5-methoxy-3-oxo-1-phenylindene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)c2ccc(OC)cc2C1(O)Cc1ccccc1.CCOC(=O)C1=C(c2ccccc2)c2ccc(OC)cc2C1=O |
| InChI | InChI=1S/C26H24O4.C19H16O4/c1-3-30-25(27)24-23(19-12-8-5-9-13-19)21-15-14-20(29-2)16-22(21)26(24,28)17-18-10-6-4-7-11-18;1-3-23-19(21)17-16(12-7-5-4-6-8-12)14-10-9-13(22-2)11-15(14)18(17)20/h4-16,28H,3,17H2,1-2H3;4-11H,3H2,1-2H3 |
| InChIKey | ZJSUGQKUFLRYLM-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.81 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|