C33H34NO7P — CID 134873267
5-O-ethyl 4-O,6-O-dimethyl 2,2-dimethyl-7-[(triphenyl-λ5-phosphanylidene)amino]-3H-oxepine-4,5,6-tricarboxylate (PubChem CID 134873267) has the molecular formula C33H34NO7P and a molecular weight of 587.61 g/mol. Its IUPAC name is 5-O-ethyl 4-O,6-O-dimethyl 2,2-dimethyl-7-[(triphenyl-λ5-phosphanylidene)amino]-3H-oxepine-4,5,6-tricarboxylate.
| Compound Name | 5-O-ethyl 4-O,6-O-dimethyl 2,2-dimethyl-7-[(triphenyl-λ5-phosphanylidene)amino]-3H-oxepine-4,5,6-tricarboxylate |
|---|---|
| PubChem CID | 134873267 |
| Molecular Formula | C33H34NO7P |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 5-O-ethyl 4-O,6-O-dimethyl 2,2-dimethyl-7-[(triphenyl-λ5-phosphanylidene)amino]-3H-oxepine-4,5,6-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OC)CC(C)(C)OC(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)=C1C(=O)OC |
| InChI | InChI=1S/C33H34NO7P/c1-6-40-32(37)27-26(30(35)38-4)22-33(2,3)41-29(28(27)31(36)39-5)34-42(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21H,6,22H2,1-5H3 |
| InChIKey | VZNSEKUCJMLPFU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|