C23H28N2O5 — CID 156612714
ethyl 2,5-dimethyl-2-[4-(3-phenylprop-2-enoyl)piperazine-1-carbonyl]-3H-furan-4-carboxylate (PubChem CID 156612714) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-2-[4-(3-phenylprop-2-enoyl)piperazine-1-carbonyl]-3H-furan-4-carboxylate.
| Compound Name | ethyl 2,5-dimethyl-2-[4-(3-phenylprop-2-enoyl)piperazine-1-carbonyl]-3H-furan-4-carboxylate |
|---|---|
| PubChem CID | 156612714 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | ethyl 2,5-dimethyl-2-[4-(3-phenylprop-2-enoyl)piperazine-1-carbonyl]-3H-furan-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(C)(C(=O)N2CCN(C(=O)C=Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C23H28N2O5/c1-4-29-21(27)19-16-23(3,30-17(19)2)22(28)25-14-12-24(13-15-25)20(26)11-10-18-8-6-5-7-9-18/h5-11H,4,12-16H2,1-3H3 |
| InChIKey | WYOQGDHRTMRYJK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|