About ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate
ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate (PubChem CID 11143605) has the molecular formula C24H24NO2P
and a molecular weight of 389.44 g/mol. Its IUPAC name is ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate |
| PubChem CID | 11143605 |
| Molecular Formula | C24H24NO2P |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate |
| SMILES | C/C=C(/N=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C24H24NO2P/c1-3-23(24(26)27-4-2)25-28(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h3,5-19H,4H2,1-2H3/b23-3+ |
| InChIKey | UJLSSDKJPMOXQQ-LTGYVZTRSA-N |
| XLogP | 4.63 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate?
The IUPAC name of ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate (CID 11143605) is ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate.
What is the SMILES notation for ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate?
The canonical SMILES for ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate is C/C=C(/N=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC.
What is the InChIKey of ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate?
The InChIKey is UJLSSDKJPMOXQQ-LTGYVZTRSA-N. The full InChI is InChI=1S/C24H24NO2P/c1-3-23(24(26)27-4-2)25-28(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h3,5-19H,4H2,1-2H3/b23-3+.
What are the key properties of ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate?
ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate has a molecular weight of 389.44 g/mol, XLogP of 4.63, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-[(triphenyl-λ5-phosphanylidene)amino]but-2-enoate is sourced from PubChem (CID 11143605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).