About 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide
4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide (PubChem CID 13438783) has the molecular formula C26H22NOP
and a molecular weight of 395.44 g/mol. Its IUPAC name is 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide.
Molecular Properties
| Compound Name | 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide |
| PubChem CID | 13438783 |
| Molecular Formula | C26H22NOP |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide |
| SMILES | Cc1ccc(C(=O)N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22NOP/c1-21-17-19-22(20-18-21)26(28)27-29(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20H,1H3 |
| InChIKey | MPVOEIIKBZIQPG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide?
The IUPAC name of 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide (CID 13438783) is 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide.
What is the SMILES notation for 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide?
The canonical SMILES for 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide is Cc1ccc(C(=O)N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide?
The InChIKey is MPVOEIIKBZIQPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22NOP/c1-21-17-19-22(20-18-21)26(28)27-29(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20H,1H3.
What are the key properties of 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide?
4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide has a molecular weight of 395.44 g/mol, XLogP of 5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(triphenyl-λ5-phosphanylidene)benzamide is sourced from PubChem (CID 13438783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).