C32H30NO3P — CID 134869082
ethyl (Z)-3-(2-prop-2-enoxyphenyl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate (PubChem CID 134869082) has the molecular formula C32H30NO3P and a molecular weight of 507.57 g/mol. Its IUPAC name is ethyl (Z)-3-(2-prop-2-enoxyphenyl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(2-prop-2-enoxyphenyl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate |
|---|---|
| PubChem CID | 134869082 |
| Molecular Formula | C32H30NO3P |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | ethyl (Z)-3-(2-prop-2-enoxyphenyl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate |
| SMILES | C=CCOc1ccccc1/C=C(\N=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C32H30NO3P/c1-3-24-36-31-23-15-14-16-26(31)25-30(32(34)35-4-2)33-37(27-17-8-5-9-18-27,28-19-10-6-11-20-28)29-21-12-7-13-22-29/h3,5-23,25H,1,4,24H2,2H3/b30-25- |
| InChIKey | KASYJXYHLPMLOA-JVCXMKTPSA-N |
| XLogP | 6.33 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|