C16H19NO5S — CID 10337147
ethyl (E,2Z)-2-methylsulfonylimino-4-(2-prop-2-enoxyphenyl)but-3-enoate (PubChem CID 10337147) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is ethyl (E,2Z)-2-methylsulfonylimino-4-(2-prop-2-enoxyphenyl)but-3-enoate.
| Compound Name | ethyl (E,2Z)-2-methylsulfonylimino-4-(2-prop-2-enoxyphenyl)but-3-enoate |
|---|---|
| PubChem CID | 10337147 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | ethyl (E,2Z)-2-methylsulfonylimino-4-(2-prop-2-enoxyphenyl)but-3-enoate |
| SMILES | C=CCOc1ccccc1/C=C/C(=N/S(C)(=O)=O)C(=O)OCC |
| InChI | InChI=1S/C16H19NO5S/c1-4-12-22-15-9-7-6-8-13(15)10-11-14(16(18)21-5-2)17-23(3,19)20/h4,6-11H,1,5,12H2,2-3H3/b11-10+,17-14- |
| InChIKey | KQYAVNMSYGLQAY-UDUOVWRXSA-N |
| XLogP | 2.23 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|