C26H29NO5 — CID 10003100
ethyl (E,2Z)-2-(oxan-2-yloxyimino)-4-[2-[(E)-3-phenylprop-2-enoxy]phenyl]but-3-enoate (PubChem CID 10003100) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is ethyl (E,2Z)-2-(oxan-2-yloxyimino)-4-[2-[(E)-3-phenylprop-2-enoxy]phenyl]but-3-enoate.
| Compound Name | ethyl (E,2Z)-2-(oxan-2-yloxyimino)-4-[2-[(E)-3-phenylprop-2-enoxy]phenyl]but-3-enoate |
|---|---|
| PubChem CID | 10003100 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | ethyl (E,2Z)-2-(oxan-2-yloxyimino)-4-[2-[(E)-3-phenylprop-2-enoxy]phenyl]but-3-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccccc1OC/C=C/c1ccccc1)=N\OC1CCCCO1 |
| InChI | InChI=1S/C26H29NO5/c1-2-29-26(28)23(27-32-25-16-8-9-19-31-25)18-17-22-14-6-7-15-24(22)30-20-10-13-21-11-4-3-5-12-21/h3-7,10-15,17-18,25H,2,8-9,16,19-20H2,1H3/b13-10+,18-17+,27-23- |
| InChIKey | GSJSMZUERSZCHE-LLJYDWQZSA-N |
| XLogP | 5.25 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|