C43H53IO8 — CID 159927882
ethyl (E,3S)-5-iodo-3-[4-(oxan-2-yloxy)phenyl]pent-4-enoate;ethyl (E,3S)-3-[4-(oxan-2-yloxy)phenyl]-6-phenylhex-4-enoate (PubChem CID 159927882) has the molecular formula C43H53IO8 and a molecular weight of 824.79 g/mol. Its IUPAC name is ethyl (E,3S)-5-iodo-3-[4-(oxan-2-yloxy)phenyl]pent-4-enoate;ethyl (E,3S)-3-[4-(oxan-2-yloxy)phenyl]-6-phenylhex-4-enoate.
| Compound Name | ethyl (E,3S)-5-iodo-3-[4-(oxan-2-yloxy)phenyl]pent-4-enoate;ethyl (E,3S)-3-[4-(oxan-2-yloxy)phenyl]-6-phenylhex-4-enoate |
|---|---|
| PubChem CID | 159927882 |
| Molecular Formula | C43H53IO8 |
| Molecular Weight | 824.79 g/mol |
| Exact Mass | 824.28 |
| IUPAC Name | ethyl (E,3S)-5-iodo-3-[4-(oxan-2-yloxy)phenyl]pent-4-enoate;ethyl (E,3S)-3-[4-(oxan-2-yloxy)phenyl]-6-phenylhex-4-enoate |
| SMILES | CCOC(=O)C[C@@H](/C=C/Cc1ccccc1)c1ccc(OC2CCCCO2)cc1.CCOC(=O)C[C@@H](/C=C/I)c1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C25H30O4.C18H23IO4/c1-2-27-24(26)19-22(12-8-11-20-9-4-3-5-10-20)21-14-16-23(17-15-21)29-25-13-6-7-18-28-25;1-2-21-17(20)13-15(10-11-19)14-6-8-16(9-7-14)23-18-5-3-4-12-22-18/h3-5,8-10,12,14-17,22,25H,2,6-7,11,13,18-19H2,1H3;6-11,15,18H,2-5,12-13H2,1H3/b12-8+;11-10+/t22-,25?;15-,18?/m11/s1 |
| InChIKey | NZGIKPTYTMZFCU-QECJWHLXSA-N |
| XLogP | 10.01 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.79 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|