C25H36O3 — CID 90796647
4-butan-2-ylphenol;2-(4-butan-2-ylphenoxy)oxane (PubChem CID 90796647) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is 4-butan-2-ylphenol;2-(4-butan-2-ylphenoxy)oxane.
| Compound Name | 4-butan-2-ylphenol;2-(4-butan-2-ylphenoxy)oxane |
|---|---|
| PubChem CID | 90796647 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 4-butan-2-ylphenol;2-(4-butan-2-ylphenoxy)oxane |
| SMILES | CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C15H22O2.C10H14O/c1-3-12(2)13-7-9-14(10-8-13)17-15-6-4-5-11-16-15;1-3-8(2)9-4-6-10(11)7-5-9/h7-10,12,15H,3-6,11H2,1-2H3;4-8,11H,3H2,1-2H3 |
| InChIKey | PJVWGZTZOHIBSV-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |