C27H38O4 — CID 142103191
ethane;oxan-2-yl 4-[2-(4-butan-2-ylphenoxy)propan-2-yl]benzoate (PubChem CID 142103191) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is ethane;oxan-2-yl 4-[2-(4-butan-2-ylphenoxy)propan-2-yl]benzoate.
| Compound Name | ethane;oxan-2-yl 4-[2-(4-butan-2-ylphenoxy)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 142103191 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | ethane;oxan-2-yl 4-[2-(4-butan-2-ylphenoxy)propan-2-yl]benzoate |
| SMILES | CC.CCC(C)c1ccc(OC(C)(C)c2ccc(C(=O)OC3CCCCO3)cc2)cc1 |
| InChI | InChI=1S/C25H32O4.C2H6/c1-5-18(2)19-11-15-22(16-12-19)29-25(3,4)21-13-9-20(10-14-21)24(26)28-23-8-6-7-17-27-23;1-2/h9-16,18,23H,5-8,17H2,1-4H3;1-2H3 |
| InChIKey | ASBKGIQIZVXCGA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |