C30H50O4Sn — CID 59218548
ethyl (3S)-3-[4-(oxan-2-yloxy)phenyl]-4-tributylstannylpent-4-enoate (PubChem CID 59218548) has the molecular formula C30H50O4Sn and a molecular weight of 593.44 g/mol. Its IUPAC name is ethyl (3S)-3-[4-(oxan-2-yloxy)phenyl]-4-tributylstannylpent-4-enoate.
| Compound Name | ethyl (3S)-3-[4-(oxan-2-yloxy)phenyl]-4-tributylstannylpent-4-enoate |
|---|---|
| PubChem CID | 59218548 |
| Molecular Formula | C30H50O4Sn |
| Molecular Weight | 593.44 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | ethyl (3S)-3-[4-(oxan-2-yloxy)phenyl]-4-tributylstannylpent-4-enoate |
| SMILES | C=C([C@@H](CC(=O)OCC)c1ccc(OC2CCCCO2)cc1)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C18H23O4.3C4H9.Sn/c1-3-14(13-17(19)20-4-2)15-8-10-16(11-9-15)22-18-7-5-6-12-21-18;3*1-3-4-2;/h8-11,14,18H,1,4-7,12-13H2,2H3;3*1,3-4H2,2H3;/t14-,18?;;;;/m0..../s1 |
| InChIKey | VIJJINZBGPQMSY-VMJPOQGHSA-N |
| XLogP | 8.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.44 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |