C15H18O3 — CID 15292046
ethyl (E)-2-methyl-3-(2-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 15292046) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is ethyl (E)-2-methyl-3-(2-prop-2-enoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-methyl-3-(2-prop-2-enoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 15292046 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | ethyl (E)-2-methyl-3-(2-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOc1ccccc1/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C15H18O3/c1-4-10-18-14-9-7-6-8-13(14)11-12(3)15(16)17-5-2/h4,6-9,11H,1,5,10H2,2-3H3/b12-11+ |
| InChIKey | GERKKXRYMGTXDK-VAWYXSNFSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|