C30H26N3O2P — CID 10917988
ethyl (E)-3-imidazo[1,2-a]pyridin-6-yl-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate (PubChem CID 10917988) has the molecular formula C30H26N3O2P and a molecular weight of 491.53 g/mol. Its IUPAC name is ethyl (E)-3-imidazo[1,2-a]pyridin-6-yl-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate.
| Compound Name | ethyl (E)-3-imidazo[1,2-a]pyridin-6-yl-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate |
|---|---|
| PubChem CID | 10917988 |
| Molecular Formula | C30H26N3O2P |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | ethyl (E)-3-imidazo[1,2-a]pyridin-6-yl-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccc2nccn2c1)N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H26N3O2P/c1-2-35-30(34)28(22-24-18-19-29-31-20-21-33(29)23-24)32-36(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-23H,2H2,1H3/b28-22+ |
| InChIKey | NWEFGOBOBSISRN-XAYXJRQQSA-N |
| XLogP | 5.42 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|