C14H21N3O — CID 157046695
2,2-dimethylpropanamide;6-ethylimidazo[1,2-a]pyridine (PubChem CID 157046695) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2,2-dimethylpropanamide;6-ethylimidazo[1,2-a]pyridine.
| Compound Name | 2,2-dimethylpropanamide;6-ethylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 157046695 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2,2-dimethylpropanamide;6-ethylimidazo[1,2-a]pyridine |
| SMILES | CC(C)(C)C(N)=O.CCc1ccc2nccn2c1 |
| InChI | InChI=1S/C9H10N2.C5H11NO/c1-2-8-3-4-9-10-5-6-11(9)7-8;1-5(2,3)4(6)7/h3-7H,2H2,1H3;1-3H3,(H2,6,7) |
| InChIKey | GABBKEIWNYYCBG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |