C11H16N2 — CID 142917283
ethane;6-ethylimidazo[1,2-a]pyridine (PubChem CID 142917283) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is ethane;6-ethylimidazo[1,2-a]pyridine.
| Compound Name | ethane;6-ethylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 142917283 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | ethane;6-ethylimidazo[1,2-a]pyridine |
| SMILES | CC.CCc1ccc2nccn2c1 |
| InChI | InChI=1S/C9H10N2.C2H6/c1-2-8-3-4-9-10-5-6-11(9)7-8;1-2/h3-7H,2H2,1H3;1-2H3 |
| InChIKey | ACOHORSKJQUXRW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |