C8H8Cl2N2 — CID 19973456
6-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride (PubChem CID 19973456) has the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. Its IUPAC name is 6-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride.
| Compound Name | 6-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride |
|---|---|
| PubChem CID | 19973456 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 6-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride |
| SMILES | Cl.ClCc1ccc2nccn2c1 |
| InChI | InChI=1S/C8H7ClN2.ClH/c9-5-7-1-2-8-10-3-4-11(8)6-7;/h1-4,6H,5H2;1H |
| InChIKey | JOZZCSFUMJALKN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|